C33H49NO9S — CID 67906984
1-[3-(3-piperidin-1-ylpropoxy)-2-propoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]sulfonylpropan-2-ol (PubChem CID 67906984) has the molecular formula C33H49NO9S and a molecular weight of 635.82 g/mol. Its IUPAC name is 1-[3-(3-piperidin-1-ylpropoxy)-2-propoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]sulfonylpropan-2-ol.
| Compound Name | 1-[3-(3-piperidin-1-ylpropoxy)-2-propoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]sulfonylpropan-2-ol |
|---|---|
| PubChem CID | 67906984 |
| Molecular Formula | C33H49NO9S |
| Molecular Weight | 635.82 g/mol |
| Exact Mass | 635.31 |
| IUPAC Name | 1-[3-(3-piperidin-1-ylpropoxy)-2-propoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]sulfonylpropan-2-ol |
| SMILES | CCCOc1c(OCCCN2CCCCC2)cc([C@H]2CC[C@H](c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CC(C)O |
| InChI | InChI=1S/C33H49NO9S/c1-6-16-42-33-30(41-17-10-15-34-13-8-7-9-14-34)20-25(21-31(33)44(36,37)22-23(2)35)27-12-11-26(43-27)24-18-28(38-3)32(40-5)29(19-24)39-4/h18-21,23,26-27,35H,6-17,22H2,1-5H3/t23?,26-,27-/m1/s1 |
| InChIKey | XEOPSHBQPDBLPO-NQZVWMNDSA-N |
| XLogP | 5.50 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.82 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|