C29H39BrO9S — CID 15078306
1-[3-(4-bromobutoxy)-2-propoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]sulfonylpropan-2-one (PubChem CID 15078306) has the molecular formula C29H39BrO9S and a molecular weight of 643.59 g/mol. Its IUPAC name is 1-[3-(4-bromobutoxy)-2-propoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]sulfonylpropan-2-one.
| Compound Name | 1-[3-(4-bromobutoxy)-2-propoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]sulfonylpropan-2-one |
|---|---|
| PubChem CID | 15078306 |
| Molecular Formula | C29H39BrO9S |
| Molecular Weight | 643.59 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | 1-[3-(4-bromobutoxy)-2-propoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]sulfonylpropan-2-one |
| SMILES | CCCOc1c(OCCCCBr)cc([C@H]2CC[C@H](c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CC(C)=O |
| InChI | InChI=1S/C29H39BrO9S/c1-6-12-38-29-26(37-13-8-7-11-30)16-21(17-27(29)40(32,33)18-19(2)31)23-10-9-22(39-23)20-14-24(34-3)28(36-5)25(15-20)35-4/h14-17,22-23H,6-13,18H2,1-5H3/t22-,23-/m1/s1 |
| InChIKey | NPUQBENUMDKMEW-DHIUTWEWSA-N |
| XLogP | 6.01 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|