C42H51O13PS — CID 10463175
dibenzyl 3-[3-(2-oxopropylsulfonyl)-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl phosphate (PubChem CID 10463175) has the molecular formula C42H51O13PS and a molecular weight of 826.90 g/mol. Its IUPAC name is dibenzyl 3-[3-(2-oxopropylsulfonyl)-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl phosphate.
| Compound Name | dibenzyl 3-[3-(2-oxopropylsulfonyl)-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl phosphate |
|---|---|
| PubChem CID | 10463175 |
| Molecular Formula | C42H51O13PS |
| Molecular Weight | 826.90 g/mol |
| Exact Mass | 826.28 |
| IUPAC Name | dibenzyl 3-[3-(2-oxopropylsulfonyl)-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl phosphate |
| SMILES | CCCOc1c(OCCCOP(=O)(OCc2ccccc2)OCc2ccccc2)cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CC(C)=O |
| InChI | InChI=1S/C42H51O13PS/c1-6-20-51-42-39(50-21-13-22-52-56(44,53-27-31-14-9-7-10-15-31)54-28-32-16-11-8-12-17-32)25-34(26-40(42)57(45,46)29-30(2)43)36-19-18-35(55-36)33-23-37(47-3)41(49-5)38(24-33)48-4/h7-12,14-17,23-26,35-36H,6,13,18-22,27-29H2,1-5H3/t35-,36-/m0/s1 |
| InChIKey | CLOBJLDHJLFAKH-ZPGRZCPFSA-N |
| XLogP | 8.78 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.90 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|