C28H39O12PS — CID 139663191
3-[3-(2-oxopropylsulfonyl)-2-propoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propylphosphonic acid (PubChem CID 139663191) has the molecular formula C28H39O12PS and a molecular weight of 630.65 g/mol. Its IUPAC name is 3-[3-(2-oxopropylsulfonyl)-2-propoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propylphosphonic acid.
| Compound Name | 3-[3-(2-oxopropylsulfonyl)-2-propoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propylphosphonic acid |
|---|---|
| PubChem CID | 139663191 |
| Molecular Formula | C28H39O12PS |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | 3-[3-(2-oxopropylsulfonyl)-2-propoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propylphosphonic acid |
| SMILES | CCCOc1c(OCCCP(=O)(O)O)cc([C@H]2CC[C@H](c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CC(C)=O |
| InChI | InChI=1S/C28H39O12PS/c1-6-10-39-28-25(38-11-7-12-41(30,31)32)15-20(16-26(28)42(33,34)17-18(2)29)22-9-8-21(40-22)19-13-23(35-3)27(37-5)24(14-19)36-4/h13-16,21-22H,6-12,17H2,1-5H3,(H2,30,31,32)/t21-,22-/m1/s1 |
| InChIKey | DIENZTAUVHUWSV-FGZHOGPDSA-N |
| XLogP | 4.40 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|