C35H39NO10S — CID 12044522
2-[(E)-4-[3-methylsulfonyl-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]but-2-enyl]isoindole-1,3-dione (PubChem CID 12044522) has the molecular formula C35H39NO10S and a molecular weight of 665.76 g/mol. Its IUPAC name is 2-[(E)-4-[3-methylsulfonyl-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]but-2-enyl]isoindole-1,3-dione.
| Compound Name | 2-[(E)-4-[3-methylsulfonyl-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]but-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 12044522 |
| Molecular Formula | C35H39NO10S |
| Molecular Weight | 665.76 g/mol |
| Exact Mass | 665.23 |
| IUPAC Name | 2-[(E)-4-[3-methylsulfonyl-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]but-2-enyl]isoindole-1,3-dione |
| SMILES | CCCOc1c(OC/C=C/CN2C(=O)c3ccccc3C2=O)cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)O2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C35H39NO10S/c1-6-16-45-33-30(44-17-10-9-15-36-34(37)24-11-7-8-12-25(24)35(36)38)20-23(21-31(33)47(5,39)40)27-14-13-26(46-27)22-18-28(41-2)32(43-4)29(19-22)42-3/h7-12,18-21,26-27H,6,13-17H2,1-5H3/b10-9+/t26-,27-/m0/s1 |
| InChIKey | WJBHAUVEWXHEJN-FSZICIINSA-N |
| XLogP | 5.73 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.76 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|