C23H31NO9S — CID 22092618
N-[2-[2-methoxy-6-methylsulfonyl-4-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]ethyl]hydroxylamine (PubChem CID 22092618) has the molecular formula C23H31NO9S and a molecular weight of 497.57 g/mol. Its IUPAC name is N-[2-[2-methoxy-6-methylsulfonyl-4-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]ethyl]hydroxylamine.
| Compound Name | N-[2-[2-methoxy-6-methylsulfonyl-4-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 22092618 |
| Molecular Formula | C23H31NO9S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[2-[2-methoxy-6-methylsulfonyl-4-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]ethyl]hydroxylamine |
| SMILES | COc1cc(C2CCC(c3cc(OC)c(OCCNO)c(S(C)(=O)=O)c3)O2)cc(OC)c1OC |
| InChI | InChI=1S/C23H31NO9S/c1-28-18-10-14(11-19(29-2)22(18)31-4)16-6-7-17(33-16)15-12-20(30-3)23(32-9-8-24-25)21(13-15)34(5,26)27/h10-13,16-17,24-25H,6-9H2,1-5H3 |
| InChIKey | IJSNOCVTIQPRNA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|