C33H52N2O10S — CID 143132577
N-butyl-N-[[4-[3-methylsulfonyl-2-propoxy-5-[(2S,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]butylamino]methoxymethyl]hydroxylamine (PubChem CID 143132577) has the molecular formula C33H52N2O10S and a molecular weight of 668.85 g/mol. Its IUPAC name is N-butyl-N-[[4-[3-methylsulfonyl-2-propoxy-5-[(2S,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]butylamino]methoxymethyl]hydroxylamine.
| Compound Name | N-butyl-N-[[4-[3-methylsulfonyl-2-propoxy-5-[(2S,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]butylamino]methoxymethyl]hydroxylamine |
|---|---|
| PubChem CID | 143132577 |
| Molecular Formula | C33H52N2O10S |
| Molecular Weight | 668.85 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | N-butyl-N-[[4-[3-methylsulfonyl-2-propoxy-5-[(2S,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]butylamino]methoxymethyl]hydroxylamine |
| SMILES | CCCCN(O)COCNCCCCOc1cc([C@@H]2CC[C@H](c3cc(OC)c(OC)c(OC)c3)O2)cc(S(C)(=O)=O)c1OCCC |
| InChI | InChI=1S/C33H52N2O10S/c1-7-9-15-35(36)23-42-22-34-14-10-11-17-43-30-20-25(21-31(46(6,37)38)33(30)44-16-8-2)27-13-12-26(45-27)24-18-28(39-3)32(41-5)29(19-24)40-4/h18-21,26-27,34,36H,7-17,22-23H2,1-6H3/t26-,27+/m1/s1 |
| InChIKey | XFAHEOXJCZIGDO-SXOMAYOGSA-N |
| XLogP | 5.67 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.85 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|