C33H50N2O10S — CID 12044510
1-butyl-1-hydroxy-3-[3-[2-propoxy-3-propylsulfonyl-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl]urea (PubChem CID 12044510) has the molecular formula C33H50N2O10S and a molecular weight of 666.83 g/mol. Its IUPAC name is 1-butyl-1-hydroxy-3-[3-[2-propoxy-3-propylsulfonyl-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl]urea.
| Compound Name | 1-butyl-1-hydroxy-3-[3-[2-propoxy-3-propylsulfonyl-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl]urea |
|---|---|
| PubChem CID | 12044510 |
| Molecular Formula | C33H50N2O10S |
| Molecular Weight | 666.83 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | 1-butyl-1-hydroxy-3-[3-[2-propoxy-3-propylsulfonyl-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propyl]urea |
| SMILES | CCCCN(O)C(=O)NCCCOc1cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)O2)cc(S(=O)(=O)CCC)c1OCCC |
| InChI | InChI=1S/C33H50N2O10S/c1-7-10-15-35(37)33(36)34-14-11-17-43-29-21-24(22-30(32(29)44-16-8-2)46(38,39)18-9-3)26-13-12-25(45-26)23-19-27(40-4)31(42-6)28(20-23)41-5/h19-22,25-26,37H,7-18H2,1-6H3,(H,34,36)/t25-,26-/m0/s1 |
| InChIKey | RHVODKFKYRISFD-UIOOFZCWSA-N |
| XLogP | 6.25 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.83 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|