C34H39NO10S — CID 59901295
2-[1-[3-methylsulfonyl-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propan-2-yl]isoindole-1,3-dione (PubChem CID 59901295) has the molecular formula C34H39NO10S and a molecular weight of 653.75 g/mol. Its IUPAC name is 2-[1-[3-methylsulfonyl-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[3-methylsulfonyl-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59901295 |
| Molecular Formula | C34H39NO10S |
| Molecular Weight | 653.75 g/mol |
| Exact Mass | 653.23 |
| IUPAC Name | 2-[1-[3-methylsulfonyl-2-propoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]propan-2-yl]isoindole-1,3-dione |
| SMILES | CCCOc1c(OCC(C)N2C(=O)c3ccccc3C2=O)cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)O2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C34H39NO10S/c1-7-14-43-32-29(44-19-20(2)35-33(36)23-10-8-9-11-24(23)34(35)37)17-22(18-30(32)46(6,38)39)26-13-12-25(45-26)21-15-27(40-3)31(42-5)28(16-21)41-4/h8-11,15-18,20,25-26H,7,12-14,19H2,1-6H3/t20?,25-,26-/m0/s1 |
| InChIKey | BFXPYTPQIVYKMD-RBCOLISLSA-N |
| XLogP | 5.56 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.75 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|