C24H32O11S2 — CID 12044496
2-[2-methoxy-6-methylsulfonyl-4-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]ethyl methanesulfonate (PubChem CID 12044496) has the molecular formula C24H32O11S2 and a molecular weight of 560.64 g/mol. Its IUPAC name is 2-[2-methoxy-6-methylsulfonyl-4-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-methoxy-6-methylsulfonyl-4-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 12044496 |
| Molecular Formula | C24H32O11S2 |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 2-[2-methoxy-6-methylsulfonyl-4-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]ethyl methanesulfonate |
| SMILES | COc1cc([C@@H]2CC[C@@H](c3cc(OC)c(OCCOS(C)(=O)=O)c(S(C)(=O)=O)c3)O2)cc(OC)c1OC |
| InChI | InChI=1S/C24H32O11S2/c1-29-19-11-15(12-20(30-2)23(19)32-4)17-7-8-18(35-17)16-13-21(31-3)24(22(14-16)36(5,25)26)33-9-10-34-37(6,27)28/h11-14,17-18H,7-10H2,1-6H3/t17-,18-/m0/s1 |
| InChIKey | POIHPZATURQLCP-ROUUACIJSA-N |
| XLogP | 3.07 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|