C32H48O7 — CID 10768909
(2R,5R)-2,5-bis(3-hexoxy-4,5-dimethoxyphenyl)oxolane (PubChem CID 10768909) has the molecular formula C32H48O7 and a molecular weight of 544.73 g/mol. Its IUPAC name is (2R,5R)-2,5-bis(3-hexoxy-4,5-dimethoxyphenyl)oxolane.
| Compound Name | (2R,5R)-2,5-bis(3-hexoxy-4,5-dimethoxyphenyl)oxolane |
|---|---|
| PubChem CID | 10768909 |
| Molecular Formula | C32H48O7 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | (2R,5R)-2,5-bis(3-hexoxy-4,5-dimethoxyphenyl)oxolane |
| SMILES | CCCCCCOc1cc([C@H]2CC[C@H](c3cc(OC)c(OC)c(OCCCCCC)c3)O2)cc(OC)c1OC |
| InChI | InChI=1S/C32H48O7/c1-7-9-11-13-17-37-29-21-23(19-27(33-3)31(29)35-5)25-15-16-26(39-25)24-20-28(34-4)32(36-6)30(22-24)38-18-14-12-10-8-2/h19-22,25-26H,7-18H2,1-6H3/t25-,26-/m1/s1 |
| InChIKey | FICJDAMMSYQXQZ-CLJLJLNGSA-N |
| XLogP | 8.23 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|