C21H26O7 — CID 11794734
2,3-dimethoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenol (PubChem CID 11794734) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is 2,3-dimethoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenol.
| Compound Name | 2,3-dimethoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenol |
|---|---|
| PubChem CID | 11794734 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2,3-dimethoxy-5-[(2R,5R)-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenol |
| SMILES | COc1cc([C@H]2CC[C@H](c3cc(OC)c(OC)c(OC)c3)O2)cc(O)c1OC |
| InChI | InChI=1S/C21H26O7/c1-23-17-9-12(8-14(22)20(17)26-4)15-6-7-16(28-15)13-10-18(24-2)21(27-5)19(11-13)25-3/h8-11,15-16,22H,6-7H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | JBESPDXLURMQQK-HZPDHXFCSA-N |
| XLogP | 4.03 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |