C19H26O5 — CID 143132571
2-[(2E)-4-methoxypenta-2,4-dien-2-yl]-5-(3,4,5-trimethoxyphenyl)oxolane (PubChem CID 143132571) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is 2-[(2E)-4-methoxypenta-2,4-dien-2-yl]-5-(3,4,5-trimethoxyphenyl)oxolane.
| Compound Name | 2-[(2E)-4-methoxypenta-2,4-dien-2-yl]-5-(3,4,5-trimethoxyphenyl)oxolane |
|---|---|
| PubChem CID | 143132571 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[(2E)-4-methoxypenta-2,4-dien-2-yl]-5-(3,4,5-trimethoxyphenyl)oxolane |
| SMILES | C=C(/C=C(\C)C1CCC(c2cc(OC)c(OC)c(OC)c2)O1)OC |
| InChI | InChI=1S/C19H26O5/c1-12(9-13(2)20-3)15-7-8-16(24-15)14-10-17(21-4)19(23-6)18(11-14)22-5/h9-11,15-16H,2,7-8H2,1,3-6H3/b12-9+ |
| InChIKey | YCUSIXFVJGTBFY-FMIVXFBMSA-N |
| XLogP | 4.04 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|