C20H23NO8 — CID 23056679
2-methoxy-6-nitro-4-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenol (PubChem CID 23056679) has the molecular formula C20H23NO8 and a molecular weight of 405.40 g/mol. Its IUPAC name is 2-methoxy-6-nitro-4-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenol.
| Compound Name | 2-methoxy-6-nitro-4-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenol |
|---|---|
| PubChem CID | 23056679 |
| Molecular Formula | C20H23NO8 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-methoxy-6-nitro-4-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenol |
| SMILES | COc1cc(C2CCC(c3cc(OC)c(OC)c(OC)c3)O2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C20H23NO8/c1-25-16-8-11(7-13(19(16)22)21(23)24)14-5-6-15(29-14)12-9-17(26-2)20(28-4)18(10-12)27-3/h7-10,14-15,22H,5-6H2,1-4H3 |
| InChIKey | LBGDAAPKWWNHSE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|