C14H15N3O6 — CID 4747333
5-acetyl-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-methylidene-1,3-diazinan-2-one (PubChem CID 4747333) has the molecular formula C14H15N3O6 and a molecular weight of 321.29 g/mol. Its IUPAC name is 5-acetyl-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-methylidene-1,3-diazinan-2-one.
| Compound Name | 5-acetyl-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-methylidene-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 4747333 |
| Molecular Formula | C14H15N3O6 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 5-acetyl-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-methylidene-1,3-diazinan-2-one |
| SMILES | C=C1NC(=O)NC(c2cc(OC)c(O)c([N+](=O)[O-])c2)C1C(C)=O |
| InChI | InChI=1S/C14H15N3O6/c1-6-11(7(2)18)12(16-14(20)15-6)8-4-9(17(21)22)13(19)10(5-8)23-3/h4-5,11-12,19H,1H2,2-3H3,(H2,15,16,20) |
| InChIKey | BKWXAEFHTBMGLO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|