C22H23N3O8 — CID 110843774
propan-2-yl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-(4-methoxyphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110843774) has the molecular formula C22H23N3O8 and a molecular weight of 457.44 g/mol. Its IUPAC name is propan-2-yl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-(4-methoxyphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-(4-methoxyphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110843774 |
| Molecular Formula | C22H23N3O8 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | propan-2-yl 4-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-(4-methoxyphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COc1ccc(C2=C(C(=O)OC(C)C)C(c3cc(OC)c(O)c([N+](=O)[O-])c3)NC(=O)N2)cc1 |
| InChI | InChI=1S/C22H23N3O8/c1-11(2)33-21(27)17-18(12-5-7-14(31-3)8-6-12)23-22(28)24-19(17)13-9-15(25(29)30)20(26)16(10-13)32-4/h5-11,19,26H,1-4H3,(H2,23,24,28) |
| InChIKey | QRYIFYSJSSSWCT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|