C23H25N3O8 — CID 110845437
methyl 4-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)-6-(4-methoxyphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110845437) has the molecular formula C23H25N3O8 and a molecular weight of 471.47 g/mol. Its IUPAC name is methyl 4-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)-6-(4-methoxyphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 4-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)-6-(4-methoxyphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110845437 |
| Molecular Formula | C23H25N3O8 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | methyl 4-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)-6-(4-methoxyphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(c2ccc(OC)cc2)NC(=O)NC1c1cc(OC)c(OC(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H25N3O8/c1-12(2)34-21-16(26(29)30)10-14(11-17(21)32-4)20-18(22(27)33-5)19(24-23(28)25-20)13-6-8-15(31-3)9-7-13/h6-12,20H,1-5H3,(H2,24,25,28) |
| InChIKey | NAKPJVHQDDLXEK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|