C22H23N3O7 — CID 110845500
methyl 4-(3,4-diethoxy-5-nitrophenyl)-2-oxo-6-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110845500) has the molecular formula C22H23N3O7 and a molecular weight of 441.44 g/mol. Its IUPAC name is methyl 4-(3,4-diethoxy-5-nitrophenyl)-2-oxo-6-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 4-(3,4-diethoxy-5-nitrophenyl)-2-oxo-6-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110845500 |
| Molecular Formula | C22H23N3O7 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | methyl 4-(3,4-diethoxy-5-nitrophenyl)-2-oxo-6-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1cc(C2NC(=O)NC(c3ccccc3)=C2C(=O)OC)cc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C22H23N3O7/c1-4-31-16-12-14(11-15(25(28)29)20(16)32-5-2)19-17(21(26)30-3)18(23-22(27)24-19)13-9-7-6-8-10-13/h6-12,19H,4-5H2,1-3H3,(H2,23,24,27) |
| InChIKey | ZSWFNBZENHZSFM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|