C30H25N3O5 — CID 51347933
4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-5-phenyl-6-(4-phenylphenyl)-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 51347933) has the molecular formula C30H25N3O5 and a molecular weight of 507.55 g/mol. Its IUPAC name is 4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-5-phenyl-6-(4-phenylphenyl)-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-5-phenyl-6-(4-phenylphenyl)-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 51347933 |
| Molecular Formula | C30H25N3O5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-5-phenyl-6-(4-phenylphenyl)-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CCOc1cc(C2NC(=O)NC(c3ccc(-c4ccccc4)cc3)=C2c2ccccc2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C30H25N3O5/c1-2-38-25-18-23(17-24(29(25)34)33(36)37)28-26(21-11-7-4-8-12-21)27(31-30(35)32-28)22-15-13-20(14-16-22)19-9-5-3-6-10-19/h3-18,28,34H,2H2,1H3,(H2,31,32,35) |
| InChIKey | QRKRWADUAMVJKN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|