C28H27N3O6 — CID 17063334
6-(3-ethoxy-4-hydroxy-5-nitrophenyl)-9-(2-methoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17063334) has the molecular formula C28H27N3O6 and a molecular weight of 501.54 g/mol. Its IUPAC name is 6-(3-ethoxy-4-hydroxy-5-nitrophenyl)-9-(2-methoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(3-ethoxy-4-hydroxy-5-nitrophenyl)-9-(2-methoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17063334 |
| Molecular Formula | C28H27N3O6 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 6-(3-ethoxy-4-hydroxy-5-nitrophenyl)-9-(2-methoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCOc1cc(C2Nc3ccccc3NC3=C2C(=O)CC(c2ccccc2OC)C3)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C28H27N3O6/c1-3-37-25-15-17(13-22(28(25)33)31(34)35)27-26-21(29-19-9-5-6-10-20(19)30-27)12-16(14-23(26)32)18-8-4-7-11-24(18)36-2/h4-11,13,15-16,27,29-30,33H,3,12,14H2,1-2H3 |
| InChIKey | FNCBIQPMLXZNFR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|