C25H26N2O8 — CID 28700874
(4R,7R)-7-(2,5-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 28700874) has the molecular formula C25H26N2O8 and a molecular weight of 482.49 g/mol. Its IUPAC name is (4R,7R)-7-(2,5-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | (4R,7R)-7-(2,5-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 28700874 |
| Molecular Formula | C25H26N2O8 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (4R,7R)-7-(2,5-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CCOc1cc([C@H]2CC(=O)NC3=C2C(=O)C[C@H](c2cc(OC)ccc2OC)C3)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C25H26N2O8/c1-4-35-22-10-14(8-19(25(22)30)27(31)32)17-12-23(29)26-18-7-13(9-20(28)24(17)18)16-11-15(33-2)5-6-21(16)34-3/h5-6,8,10-11,13,17,30H,4,7,9,12H2,1-3H3,(H,26,29)/t13-,17-/m1/s1 |
| InChIKey | UXRVTKZRVXCELC-CXAGYDPISA-N |
| XLogP | 3.72 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|