C24H24N2O8 — CID 28789943
(4R,7R)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 28789943) has the molecular formula C24H24N2O8 and a molecular weight of 468.46 g/mol. Its IUPAC name is (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 28789943 |
| Molecular Formula | C24H24N2O8 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)NC(=O)C[C@@H]3c2cc(OC)c(O)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C24H24N2O8/c1-32-19-5-4-12(9-20(19)33-2)13-6-16-23(18(27)8-13)15(11-22(28)25-16)14-7-17(26(30)31)24(29)21(10-14)34-3/h4-5,7,9-10,13,15,29H,6,8,11H2,1-3H3,(H,25,28)/t13-,15-/m1/s1 |
| InChIKey | NWAYBMGAUOHTIJ-UKRRQHHQSA-N |
| XLogP | 3.33 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|