C25H25NO6 — CID 41123558
methyl 4-[(4S,7S)-7-(3,4-dimethoxyphenyl)-2,5-dioxo-1,3,4,6,7,8-hexahydroquinolin-4-yl]benzoate (PubChem CID 41123558) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is methyl 4-[(4S,7S)-7-(3,4-dimethoxyphenyl)-2,5-dioxo-1,3,4,6,7,8-hexahydroquinolin-4-yl]benzoate.
| Compound Name | methyl 4-[(4S,7S)-7-(3,4-dimethoxyphenyl)-2,5-dioxo-1,3,4,6,7,8-hexahydroquinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 41123558 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | methyl 4-[(4S,7S)-7-(3,4-dimethoxyphenyl)-2,5-dioxo-1,3,4,6,7,8-hexahydroquinolin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2CC(=O)NC3=C2C(=O)C[C@@H](c2ccc(OC)c(OC)c2)C3)cc1 |
| InChI | InChI=1S/C25H25NO6/c1-30-21-9-8-16(12-22(21)31-2)17-10-19-24(20(27)11-17)18(13-23(28)26-19)14-4-6-15(7-5-14)25(29)32-3/h4-9,12,17-18H,10-11,13H2,1-3H3,(H,26,28)/t17-,18-/m0/s1 |
| InChIKey | QAKNWIDTAHBGIK-ROUUACIJSA-N |
| XLogP | 3.49 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |