C28H29NO7 — CID 995633
methyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-methoxycarbonylphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 995633) has the molecular formula C28H29NO7 and a molecular weight of 491.54 g/mol. Its IUPAC name is methyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-methoxycarbonylphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | methyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-methoxycarbonylphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 995633 |
| Molecular Formula | C28H29NO7 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | methyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-methoxycarbonylphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@H]1c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C28H29NO7/c1-15-24(28(32)36-5)25(16-6-8-17(9-7-16)27(31)35-4)26-20(29-15)12-19(13-21(26)30)18-10-11-22(33-2)23(14-18)34-3/h6-11,14,19,25,29H,12-13H2,1-5H3/t19-,25-/m0/s1 |
| InChIKey | FJTZMUWOGWHFBM-DFBJGRDBSA-N |
| XLogP | 4.03 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |