C28H30BrNO7 — CID 995655
methyl (4S,7S)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 995655) has the molecular formula C28H30BrNO7 and a molecular weight of 572.45 g/mol. Its IUPAC name is methyl (4S,7S)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | methyl (4S,7S)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 995655 |
| Molecular Formula | C28H30BrNO7 |
| Molecular Weight | 572.45 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | methyl (4S,7S)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cc(Br)c(OC)c(OC)c1 |
| InChI | InChI=1S/C28H30BrNO7/c1-14-24(28(32)37-6)25(17-9-18(29)27(36-5)23(13-17)35-4)26-19(30-14)10-16(11-20(26)31)15-7-8-21(33-2)22(12-15)34-3/h7-9,12-13,16,25,30H,10-11H2,1-6H3/t16-,25+/m0/s1 |
| InChIKey | DBRALEWLKSXVJD-IVCQMTBJSA-N |
| XLogP | 5.02 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |