C30H34BrNO7 — CID 98122924
propan-2-yl (4R,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98122924) has the molecular formula C30H34BrNO7 and a molecular weight of 600.51 g/mol. Its IUPAC name is propan-2-yl (4R,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | propan-2-yl (4R,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98122924 |
| Molecular Formula | C30H34BrNO7 |
| Molecular Weight | 600.51 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | propan-2-yl (4R,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OC(C)C)[C@@H]3c2cc(Br)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C30H34BrNO7/c1-15(2)39-30(34)26-16(3)32-21-11-18(17-8-9-23(35-4)24(13-17)36-5)12-22(33)28(21)27(26)19-10-20(31)29(38-7)25(14-19)37-6/h8-10,13-15,18,27,32H,11-12H2,1-7H3/t18-,27+/m1/s1 |
| InChIKey | NHKCKZRSCDFFKN-CLYVBNDRSA-N |
| XLogP | 5.80 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |