C32H38BrNO7 — CID 98300009
[(2S)-butan-2-yl] (4R,7R)-4-(3-bromo-5-ethoxy-4-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98300009) has the molecular formula C32H38BrNO7 and a molecular weight of 628.56 g/mol. Its IUPAC name is [(2S)-butan-2-yl] (4R,7R)-4-(3-bromo-5-ethoxy-4-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2S)-butan-2-yl] (4R,7R)-4-(3-bromo-5-ethoxy-4-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98300009 |
| Molecular Formula | C32H38BrNO7 |
| Molecular Weight | 628.56 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | [(2S)-butan-2-yl] (4R,7R)-4-(3-bromo-5-ethoxy-4-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCOc1cc([C@H]2C(C(=O)O[C@@H](C)CC)=C(C)NC3=C2C(=O)C[C@H](c2ccc(OC)c(OC)c2)C3)cc(Br)c1OC |
| InChI | InChI=1S/C32H38BrNO7/c1-8-17(3)41-32(36)28-18(4)34-23-13-20(19-10-11-25(37-5)26(15-19)38-6)14-24(35)30(23)29(28)21-12-22(33)31(39-7)27(16-21)40-9-2/h10-12,15-17,20,29,34H,8-9,13-14H2,1-7H3/t17-,20+,29-/m0/s1 |
| InChIKey | BYFAUIUQQWPRQU-QHBODZGPSA-N |
| XLogP | 6.58 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.56 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |