C31H36BrNO7 — CID 98122928
[(2S)-butan-2-yl] (4S,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98122928) has the molecular formula C31H36BrNO7 and a molecular weight of 614.53 g/mol. Its IUPAC name is [(2S)-butan-2-yl] (4S,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2S)-butan-2-yl] (4S,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98122928 |
| Molecular Formula | C31H36BrNO7 |
| Molecular Weight | 614.53 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | [(2S)-butan-2-yl] (4S,7R)-4-(3-bromo-4,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC[C@H](C)OC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cc(Br)c(OC)c(OC)c1 |
| InChI | InChI=1S/C31H36BrNO7/c1-8-16(2)40-31(35)27-17(3)33-22-12-19(18-9-10-24(36-4)25(14-18)37-5)13-23(34)29(22)28(27)20-11-21(32)30(39-7)26(15-20)38-6/h9-11,14-16,19,28,33H,8,12-13H2,1-7H3/t16-,19+,28+/m0/s1 |
| InChIKey | XXJFTXQYOOHVJZ-VGHVDPOBSA-N |
| XLogP | 6.19 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |