C30H35NO5S — CID 1207024
[(2S)-butan-2-yl] (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylsulfanylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1207024) has the molecular formula C30H35NO5S and a molecular weight of 521.68 g/mol. Its IUPAC name is [(2S)-butan-2-yl] (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylsulfanylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2S)-butan-2-yl] (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylsulfanylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1207024 |
| Molecular Formula | C30H35NO5S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | [(2S)-butan-2-yl] (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylsulfanylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC[C@H](C)OC(=O)C1=C(C)NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@H]1c1ccc(SC)cc1 |
| InChI | InChI=1S/C30H35NO5S/c1-7-17(2)36-30(33)27-18(3)31-23-14-21(20-10-13-25(34-4)26(16-20)35-5)15-24(32)29(23)28(27)19-8-11-22(37-6)12-9-19/h8-13,16-17,21,28,31H,7,14-15H2,1-6H3/t17-,21-,28-/m0/s1 |
| InChIKey | AELFOMNPMYSOTC-XJTARGMPSA-N |
| XLogP | 6.13 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |