C30H35NO7 — CID 51375617
[(2R)-butan-2-yl] (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxy-4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 51375617) has the molecular formula C30H35NO7 and a molecular weight of 521.61 g/mol. Its IUPAC name is [(2R)-butan-2-yl] (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxy-4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2R)-butan-2-yl] (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxy-4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 51375617 |
| Molecular Formula | C30H35NO7 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | [(2R)-butan-2-yl] (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxy-4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC[C@@H](C)OC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C30H35NO7/c1-7-16(2)38-30(34)27-17(3)31-21-12-20(18-8-11-25(36-5)26(15-18)37-6)14-23(33)29(21)28(27)19-9-10-24(35-4)22(32)13-19/h8-11,13,15-16,20,28,31-32H,7,12,14H2,1-6H3/t16-,20-,28-/m1/s1 |
| InChIKey | XZAWRZJQSSASPD-FYOXXRTDSA-N |
| XLogP | 5.12 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |