C31H37NO7 — CID 6547420
[(2R)-butan-2-yl] (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 6547420) has the molecular formula C31H37NO7 and a molecular weight of 535.64 g/mol. Its IUPAC name is [(2R)-butan-2-yl] (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2R)-butan-2-yl] (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 6547420 |
| Molecular Formula | C31H37NO7 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | [(2R)-butan-2-yl] (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCOc1cc([C@H]2C(C(=O)O[C@H](C)CC)=C(C)NC3=C2C(=O)C[C@@H](c2ccc(OC)c(OC)c2)C3)ccc1O |
| InChI | InChI=1S/C31H37NO7/c1-7-17(3)39-31(35)28-18(4)32-22-13-21(19-10-12-25(36-5)27(15-19)37-6)14-24(34)30(22)29(28)20-9-11-23(33)26(16-20)38-8-2/h9-12,15-17,21,29,32-33H,7-8,13-14H2,1-6H3/t17-,21+,29+/m1/s1 |
| InChIKey | NFLKANHIFXMTHP-PERKSXPMSA-N |
| XLogP | 5.51 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |