C32H39NO8 — CID 98122949
2-propan-2-yloxyethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98122949) has the molecular formula C32H39NO8 and a molecular weight of 565.66 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-propan-2-yloxyethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98122949 |
| Molecular Formula | C32H39NO8 |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | 2-propan-2-yloxyethyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCOc1cc([C@H]2C(C(=O)OCCOC(C)C)=C(C)NC3=C2C(=O)C[C@H](c2ccc(OC)c(OC)c2)C3)ccc1O |
| InChI | InChI=1S/C32H39NO8/c1-7-39-27-17-21(8-10-24(27)34)30-29(32(36)41-13-12-40-18(2)3)19(4)33-23-14-22(15-25(35)31(23)30)20-9-11-26(37-5)28(16-20)38-6/h8-11,16-18,22,30,33-34H,7,12-15H2,1-6H3/t22-,30+/m1/s1 |
| InChIKey | FUOQAYXHADBSHX-RCRUUEGKSA-N |
| XLogP | 5.14 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|