C30H35NO7 — CID 38990046
butyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxy-4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 38990046) has the molecular formula C30H35NO7 and a molecular weight of 521.61 g/mol. Its IUPAC name is butyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxy-4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | butyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxy-4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 38990046 |
| Molecular Formula | C30H35NO7 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | butyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxy-4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@H]1c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C30H35NO7/c1-6-7-12-38-30(34)27-17(2)31-21-13-20(18-8-11-25(36-4)26(16-18)37-5)15-23(33)29(21)28(27)19-9-10-24(35-3)22(32)14-19/h8-11,14,16,20,28,31-32H,6-7,12-13,15H2,1-5H3/t20-,28-/m0/s1 |
| InChIKey | GXWHGKBLCKKBQS-MMTVBGGISA-N |
| XLogP | 5.12 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|