C34H35NO7 — CID 996151
2-phenylethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxy-3-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 996151) has the molecular formula C34H35NO7 and a molecular weight of 569.65 g/mol. Its IUPAC name is 2-phenylethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxy-3-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-phenylethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxy-3-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 996151 |
| Molecular Formula | C34H35NO7 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | 2-phenylethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxy-3-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1cc([C@H]2C(C(=O)OCCc3ccccc3)=C(C)NC3=C2C(=O)C[C@@H](c2ccc(OC)c(OC)c2)C3)ccc1O |
| InChI | InChI=1S/C34H35NO7/c1-20-31(34(38)42-15-14-21-8-6-5-7-9-21)32(23-10-12-26(36)29(19-23)40-3)33-25(35-20)16-24(17-27(33)37)22-11-13-28(39-2)30(18-22)41-4/h5-13,18-19,24,32,35-36H,14-17H2,1-4H3/t24-,32-/m0/s1 |
| InChIKey | YRBVPSYWFFDXNB-BNHRFMORSA-N |
| XLogP | 5.57 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |