C32H31NO6 — CID 996345
benzyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 996345) has the molecular formula C32H31NO6 and a molecular weight of 525.60 g/mol. Its IUPAC name is benzyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | benzyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 996345 |
| Molecular Formula | C32H31NO6 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | benzyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OCc2ccccc2)[C@@H]3c2ccc(O)cc2)cc1OC |
| InChI | InChI=1S/C32H31NO6/c1-19-29(32(36)39-18-20-7-5-4-6-8-20)30(21-9-12-24(34)13-10-21)31-25(33-19)15-23(16-26(31)35)22-11-14-27(37-2)28(17-22)38-3/h4-14,17,23,30,33-34H,15-16,18H2,1-3H3/t23-,30-/m0/s1 |
| InChIKey | DAQZOHPYWPPOQG-JHOBJCJYSA-N |
| XLogP | 5.51 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |