C35H37NO7 — CID 98182348
2-methoxyethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98182348) has the molecular formula C35H37NO7 and a molecular weight of 583.68 g/mol. Its IUPAC name is 2-methoxyethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-methoxyethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98182348 |
| Molecular Formula | C35H37NO7 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | 2-methoxyethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C35H37NO7/c1-22-32(35(38)42-16-15-39-2)33(25-11-8-12-27(17-25)43-21-23-9-6-5-7-10-23)34-28(36-22)18-26(19-29(34)37)24-13-14-30(40-3)31(20-24)41-4/h5-14,17,20,26,33,36H,15-16,18-19,21H2,1-4H3/t26-,33-/m1/s1 |
| InChIKey | KDMYLNMBVCMKRT-UTONBFNKSA-N |
| XLogP | 5.83 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|