C37H41NO8 — CID 98182307
2-phenoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-methoxy-4-propoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98182307) has the molecular formula C37H41NO8 and a molecular weight of 627.73 g/mol. Its IUPAC name is 2-phenoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-methoxy-4-propoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-phenoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-methoxy-4-propoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98182307 |
| Molecular Formula | C37H41NO8 |
| Molecular Weight | 627.73 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | 2-phenoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(3-methoxy-4-propoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCCOc1ccc([C@@H]2C(C(=O)OCCOc3ccccc3)=C(C)NC3=C2C(=O)C[C@@H](c2ccc(OC)c(OC)c2)C3)cc1OC |
| InChI | InChI=1S/C37H41NO8/c1-6-16-45-31-15-13-25(22-33(31)43-5)35-34(37(40)46-18-17-44-27-10-8-7-9-11-27)23(2)38-28-19-26(20-29(39)36(28)35)24-12-14-30(41-3)32(21-24)42-4/h7-15,21-22,26,35,38H,6,16-20H2,1-5H3/t26-,35+/m0/s1 |
| InChIKey | YYJZXPBXHCDNCV-OSPAZUARSA-N |
| XLogP | 6.49 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.73 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|