C37H39NO9 — CID 99687877
2-phenoxyethyl (4S,7S)-4-(4-acetyloxy-3-ethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 99687877) has the molecular formula C37H39NO9 and a molecular weight of 641.72 g/mol. Its IUPAC name is 2-phenoxyethyl (4S,7S)-4-(4-acetyloxy-3-ethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-phenoxyethyl (4S,7S)-4-(4-acetyloxy-3-ethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 99687877 |
| Molecular Formula | C37H39NO9 |
| Molecular Weight | 641.72 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | 2-phenoxyethyl (4S,7S)-4-(4-acetyloxy-3-ethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCOc1cc([C@@H]2C(C(=O)OCCOc3ccccc3)=C(C)NC3=C2C(=O)C[C@@H](c2ccc(OC)c(OC)c2)C3)ccc1OC(C)=O |
| InChI | InChI=1S/C37H39NO9/c1-6-44-33-21-25(13-15-31(33)47-23(3)39)35-34(37(41)46-17-16-45-27-10-8-7-9-11-27)22(2)38-28-18-26(19-29(40)36(28)35)24-12-14-30(42-4)32(20-24)43-5/h7-15,20-21,26,35,38H,6,16-19H2,1-5H3/t26-,35+/m0/s1 |
| InChIKey | HBMNNYDGLOJVEF-OSPAZUARSA-N |
| XLogP | 6.01 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.72 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|