C35H35NO8 — CID 98182914
2-phenoxyethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-methoxycarbonylphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98182914) has the molecular formula C35H35NO8 and a molecular weight of 597.66 g/mol. Its IUPAC name is 2-phenoxyethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-methoxycarbonylphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-phenoxyethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-methoxycarbonylphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98182914 |
| Molecular Formula | C35H35NO8 |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | 2-phenoxyethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-4-(4-methoxycarbonylphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COC(=O)c1ccc([C@H]2C(C(=O)OCCOc3ccccc3)=C(C)NC3=C2C(=O)C[C@@H](c2ccc(OC)c(OC)c2)C3)cc1 |
| InChI | InChI=1S/C35H35NO8/c1-21-31(35(39)44-17-16-43-26-8-6-5-7-9-26)32(22-10-12-23(13-11-22)34(38)42-4)33-27(36-21)18-25(19-28(33)37)24-14-15-29(40-2)30(20-24)41-3/h5-15,20,25,32,36H,16-19H2,1-4H3/t25-,32-/m0/s1 |
| InChIKey | ZCIBPDLQUXDVRG-UKJJDJLKSA-N |
| XLogP | 5.47 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|