C40H39NO7 — CID 99668288
2-phenoxyethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 99668288) has the molecular formula C40H39NO7 and a molecular weight of 645.75 g/mol. Its IUPAC name is 2-phenoxyethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-phenoxyethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 99668288 |
| Molecular Formula | C40H39NO7 |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | 2-phenoxyethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OCCOc2ccccc2)[C@@H]3c2ccccc2OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C40H39NO7/c1-26-37(40(43)47-21-20-46-30-14-8-5-9-15-30)38(31-16-10-11-17-34(31)48-25-27-12-6-4-7-13-27)39-32(41-26)22-29(23-33(39)42)28-18-19-35(44-2)36(24-28)45-3/h4-19,24,29,38,41H,20-23,25H2,1-3H3/t29-,38-/m0/s1 |
| InChIKey | ZTUKLNHJEHCEDX-HTOJEEBVSA-N |
| XLogP | 7.27 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|