C37H41NO7 — CID 98182327
2-propan-2-yloxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98182327) has the molecular formula C37H41NO7 and a molecular weight of 611.74 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-propan-2-yloxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98182327 |
| Molecular Formula | C37H41NO7 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | 2-propan-2-yloxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OCCOC(C)C)[C@H]3c2ccccc2OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C37H41NO7/c1-23(2)43-17-18-44-37(40)34-24(3)38-29-19-27(26-15-16-32(41-4)33(21-26)42-5)20-30(39)36(29)35(34)28-13-9-10-14-31(28)45-22-25-11-7-6-8-12-25/h6-16,21,23,27,35,38H,17-20,22H2,1-5H3/t27-,35+/m0/s1 |
| InChIKey | GFFVWMUFOXNOCM-JCVFDAPQSA-N |
| XLogP | 6.61 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|