C33H39NO9 — CID 3141944
2-propan-2-yloxyethyl 4-(4-acetyloxy-3-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 3141944) has the molecular formula C33H39NO9 and a molecular weight of 593.67 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 4-(4-acetyloxy-3-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-propan-2-yloxyethyl 4-(4-acetyloxy-3-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 3141944 |
| Molecular Formula | C33H39NO9 |
| Molecular Weight | 593.67 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 2-propan-2-yloxyethyl 4-(4-acetyloxy-3-methoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc(C2CC(=O)C3=C(C2)NC(C)=C(C(=O)OCCOC(C)C)C3c2ccc(OC(C)=O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C33H39NO9/c1-18(2)41-12-13-42-33(37)30-19(3)34-24-14-23(21-8-10-26(38-5)28(16-21)39-6)15-25(36)32(24)31(30)22-9-11-27(43-20(4)35)29(17-22)40-7/h8-11,16-18,23,31,34H,12-15H2,1-7H3 |
| InChIKey | MCAKNBUVHVSDJK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|