C33H39NO8 — CID 5452891
[(2S)-butan-2-yl] (4R,7R)-4-(4-acetyloxy-3-ethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 5452891) has the molecular formula C33H39NO8 and a molecular weight of 577.67 g/mol. Its IUPAC name is [(2S)-butan-2-yl] (4R,7R)-4-(4-acetyloxy-3-ethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2S)-butan-2-yl] (4R,7R)-4-(4-acetyloxy-3-ethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 5452891 |
| Molecular Formula | C33H39NO8 |
| Molecular Weight | 577.67 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | [(2S)-butan-2-yl] (4R,7R)-4-(4-acetyloxy-3-ethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCOc1cc([C@H]2C(C(=O)O[C@@H](C)CC)=C(C)NC3=C2C(=O)C[C@H](c2ccc(OC)c(OC)c2)C3)ccc1OC(C)=O |
| InChI | InChI=1S/C33H39NO8/c1-8-18(3)41-33(37)30-19(4)34-24-14-23(21-10-12-26(38-6)28(16-21)39-7)15-25(36)32(24)31(30)22-11-13-27(42-20(5)35)29(17-22)40-9-2/h10-13,16-18,23,31,34H,8-9,14-15H2,1-7H3/t18-,23+,31-/m0/s1 |
| InChIKey | CSRSMRKNNHIIJX-UPBMWPMOSA-N |
| XLogP | 5.73 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|