C30H35NO5 — CID 994846
[(2R)-butan-2-yl] (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 994846) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is [(2R)-butan-2-yl] (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2R)-butan-2-yl] (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 994846 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | [(2R)-butan-2-yl] (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC[C@@H](C)OC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C30H35NO5/c1-7-18(3)36-30(33)27-19(4)31-23-14-22(21-12-13-25(34-5)26(16-21)35-6)15-24(32)29(23)28(27)20-10-8-17(2)9-11-20/h8-13,16,18,22,28,31H,7,14-15H2,1-6H3/t18-,22-,28+/m1/s1 |
| InChIKey | VRSQPJPADYNZPN-RENKFEOJSA-N |
| XLogP | 5.72 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |