C31H37NO7 — CID 3135286
butan-2-yl 4-(2,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 3135286) has the molecular formula C31H37NO7 and a molecular weight of 535.64 g/mol. Its IUPAC name is butan-2-yl 4-(2,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | butan-2-yl 4-(2,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 3135286 |
| Molecular Formula | C31H37NO7 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | butan-2-yl 4-(2,5-dimethoxyphenyl)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCC(C)OC(=O)C1=C(C)NC2=C(C(=O)CC(c3ccc(OC)c(OC)c3)C2)C1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C31H37NO7/c1-8-17(2)39-31(34)28-18(3)32-23-13-20(19-9-11-26(37-6)27(15-19)38-7)14-24(33)30(23)29(28)22-16-21(35-4)10-12-25(22)36-5/h9-12,15-17,20,29,32H,8,13-14H2,1-7H3 |
| InChIKey | ORBZVUZXLMPVFM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |