C30H34BrNO6 — CID 98120521
[(2R)-butan-2-yl] (4R,7R)-4-(2-bromo-4,5-dimethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98120521) has the molecular formula C30H34BrNO6 and a molecular weight of 584.51 g/mol. Its IUPAC name is [(2R)-butan-2-yl] (4R,7R)-4-(2-bromo-4,5-dimethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2R)-butan-2-yl] (4R,7R)-4-(2-bromo-4,5-dimethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98120521 |
| Molecular Formula | C30H34BrNO6 |
| Molecular Weight | 584.51 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | [(2R)-butan-2-yl] (4R,7R)-4-(2-bromo-4,5-dimethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC[C@@H](C)OC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccc(OC)cc3)C2)[C@H]1c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C30H34BrNO6/c1-7-16(2)38-30(34)27-17(3)32-23-12-19(18-8-10-20(35-4)11-9-18)13-24(33)29(23)28(27)21-14-25(36-5)26(37-6)15-22(21)31/h8-11,14-16,19,28,32H,7,12-13H2,1-6H3/t16-,19-,28+/m1/s1 |
| InChIKey | UXDYYOUDMJICQL-RCAOJXLUSA-N |
| XLogP | 6.18 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |