C27H31NO5S — CID 5445864
[(2S)-butan-2-yl] (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 5445864) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is [(2S)-butan-2-yl] (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(2S)-butan-2-yl] (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 5445864 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [(2S)-butan-2-yl] (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC[C@H](C)OC(=O)C1=C(C)NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C27H31NO5S/c1-6-15(2)33-27(30)24-16(3)28-19-12-18(17-9-10-21(31-4)22(14-17)32-5)13-20(29)25(19)26(24)23-8-7-11-34-23/h7-11,14-15,18,26,28H,6,12-13H2,1-5H3/t15-,18-,26+/m0/s1 |
| InChIKey | CTBCVCBQDBCCCY-XOETXKDRSA-N |
| XLogP | 5.47 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |