C28H31NO5S — CID 1107453
cyclopentyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1107453) has the molecular formula C28H31NO5S and a molecular weight of 493.63 g/mol. Its IUPAC name is cyclopentyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | cyclopentyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1107453 |
| Molecular Formula | C28H31NO5S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | cyclopentyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OC2CCCC2)[C@H]3c2cccs2)cc1OC |
| InChI | InChI=1S/C28H31NO5S/c1-16-25(28(31)34-19-7-4-5-8-19)27(24-9-6-12-35-24)26-20(29-16)13-18(14-21(26)30)17-10-11-22(32-2)23(15-17)33-3/h6,9-12,15,18-19,27,29H,4-5,7-8,13-14H2,1-3H3/t18-,27+/m0/s1 |
| InChIKey | VMHNWPXHTZNJHO-XRHLQHRESA-N |
| XLogP | 5.61 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |