C31H35NO6 — CID 996442
cyclohexyl (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 996442) has the molecular formula C31H35NO6 and a molecular weight of 517.62 g/mol. Its IUPAC name is cyclohexyl (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | cyclohexyl (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 996442 |
| Molecular Formula | C31H35NO6 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | cyclohexyl (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)NC(C)=C(C(=O)OC2CCCCC2)[C@H]3c2cccc(O)c2)cc1OC |
| InChI | InChI=1S/C31H35NO6/c1-18-28(31(35)38-23-10-5-4-6-11-23)29(20-8-7-9-22(33)14-20)30-24(32-18)15-21(16-25(30)34)19-12-13-26(36-2)27(17-19)37-3/h7-9,12-14,17,21,23,29,32-33H,4-6,10-11,15-16H2,1-3H3/t21-,29-/m1/s1 |
| InChIKey | WLLFWOYEROQTAF-ONOMSOESSA-N |
| XLogP | 5.65 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |