C35H43NO7 — CID 98183121
cyclohexyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-methoxy-4-propoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98183121) has the molecular formula C35H43NO7 and a molecular weight of 589.73 g/mol. Its IUPAC name is cyclohexyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-methoxy-4-propoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | cyclohexyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-methoxy-4-propoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98183121 |
| Molecular Formula | C35H43NO7 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | cyclohexyl (4R,7R)-7-(3,4-dimethoxyphenyl)-4-(3-methoxy-4-propoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCCOc1ccc([C@H]2C(C(=O)OC3CCCCC3)=C(C)NC3=C2C(=O)C[C@H](c2ccc(OC)c(OC)c2)C3)cc1OC |
| InChI | InChI=1S/C35H43NO7/c1-6-16-42-29-15-13-23(20-31(29)41-5)33-32(35(38)43-25-10-8-7-9-11-25)21(2)36-26-17-24(18-27(37)34(26)33)22-12-14-28(39-3)30(19-22)40-4/h12-15,19-20,24-25,33,36H,6-11,16-18H2,1-5H3/t24-,33+/m1/s1 |
| InChIKey | YCVNKPFUCPWEJB-IANOAQMISA-N |
| XLogP | 6.74 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |